C11H14N4O2S — CID 65337012
4-N-(2-methylsulfonylethyl)quinazoline-4,7-diamine (PubChem CID 65337012) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 4-N-(2-methylsulfonylethyl)quinazoline-4,7-diamine.
| Compound Name | 4-N-(2-methylsulfonylethyl)quinazoline-4,7-diamine |
|---|---|
| PubChem CID | 65337012 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 4-N-(2-methylsulfonylethyl)quinazoline-4,7-diamine |
| SMILES | CS(=O)(=O)CCNc1ncnc2cc(N)ccc12 |
| InChI | InChI=1S/C11H14N4O2S/c1-18(16,17)5-4-13-11-9-3-2-8(12)6-10(9)14-7-15-11/h2-3,6-7H,4-5,12H2,1H3,(H,13,14,15) |
| InChIKey | VHSBAHXLXIJVFT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|