C16H23N5O2 — CID 104932831
tert-butyl N-[3-[(7-aminoquinazolin-4-yl)amino]propyl]carbamate (PubChem CID 104932831) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is tert-butyl N-[3-[(7-aminoquinazolin-4-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(7-aminoquinazolin-4-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 104932831 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | tert-butyl N-[3-[(7-aminoquinazolin-4-yl)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1ncnc2cc(N)ccc12 |
| InChI | InChI=1S/C16H23N5O2/c1-16(2,3)23-15(22)19-8-4-7-18-14-12-6-5-11(17)9-13(12)20-10-21-14/h5-6,9-10H,4,7-8,17H2,1-3H3,(H,19,22)(H,18,20,21) |
| InChIKey | FJFRRESTKOMNJC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|