C19H27N7O2 — CID 142746123
tert-butyl N-[4-[(7-amino-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]carbamate (PubChem CID 142746123) has the molecular formula C19H27N7O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is tert-butyl N-[4-[(7-amino-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(7-amino-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 142746123 |
| Molecular Formula | C19H27N7O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | tert-butyl N-[4-[(7-amino-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]carbamate |
| SMILES | Cc1nnc2c(NCCCCNC(=O)OC(C)(C)C)nc3cc(N)ccc3n12 |
| InChI | InChI=1S/C19H27N7O2/c1-12-24-25-17-16(23-14-11-13(20)7-8-15(14)26(12)17)21-9-5-6-10-22-18(27)28-19(2,3)4/h7-8,11H,5-6,9-10,20H2,1-4H3,(H,21,23)(H,22,27) |
| InChIKey | MAYKNXDAJMQJAJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|