C21H30N6O3 — CID 135276476
tert-butyl N-[4-[(7-methoxy-1,8-dimethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]carbamate (PubChem CID 135276476) has the molecular formula C21H30N6O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is tert-butyl N-[4-[(7-methoxy-1,8-dimethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(7-methoxy-1,8-dimethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 135276476 |
| Molecular Formula | C21H30N6O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | tert-butyl N-[4-[(7-methoxy-1,8-dimethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]carbamate |
| SMILES | COc1cc2nc(NCCCCNC(=O)OC(C)(C)C)c3nnc(C)n3c2cc1C |
| InChI | InChI=1S/C21H30N6O3/c1-13-11-16-15(12-17(13)29-6)24-18(19-26-25-14(2)27(16)19)22-9-7-8-10-23-20(28)30-21(3,4)5/h11-12H,7-10H2,1-6H3,(H,22,24)(H,23,28) |
| InChIKey | RSVUSPOXUIVBNK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|