C22H24ClN7O3 — CID 146342055
2-chloro-N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]pyridine-3-carboxamide (PubChem CID 146342055) has the molecular formula C22H24ClN7O3 and a molecular weight of 469.93 g/mol. Its IUPAC name is 2-chloro-N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146342055 |
| Molecular Formula | C22H24ClN7O3 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 2-chloro-N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]pyridine-3-carboxamide |
| SMILES | COc1cc2nc(NCCCCNC(=O)c3cccnc3Cl)c3nnc(C)n3c2cc1OC |
| InChI | InChI=1S/C22H24ClN7O3/c1-13-28-29-21-20(27-15-11-17(32-2)18(33-3)12-16(15)30(13)21)25-8-4-5-9-26-22(31)14-7-6-10-24-19(14)23/h6-7,10-12H,4-5,8-9H2,1-3H3,(H,25,27)(H,26,31) |
| InChIKey | PADQXZDFEZVDOO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|