C24H26ClN5O3 — CID 158779025
1-(4-chlorophenyl)-6-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]hexan-1-one (PubChem CID 158779025) has the molecular formula C24H26ClN5O3 and a molecular weight of 467.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]hexan-1-one.
| Compound Name | 1-(4-chlorophenyl)-6-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]hexan-1-one |
|---|---|
| PubChem CID | 158779025 |
| Molecular Formula | C24H26ClN5O3 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 1-(4-chlorophenyl)-6-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]hexan-1-one |
| SMILES | COc1cc2nc(NCCCCCC(=O)c3ccc(Cl)cc3)c3nnc(C)n3c2cc1OC |
| InChI | InChI=1S/C24H26ClN5O3/c1-15-28-29-24-23(27-18-13-21(32-2)22(33-3)14-19(18)30(15)24)26-12-6-4-5-7-20(31)16-8-10-17(25)11-9-16/h8-11,13-14H,4-7,12H2,1-3H3,(H,26,27) |
| InChIKey | IQVKHQWEZALULU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|