C26H31N5O4 — CID 158431770
propan-2-yl 6-[(7,8-dimethoxy-1-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]hexanoate (PubChem CID 158431770) has the molecular formula C26H31N5O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is propan-2-yl 6-[(7,8-dimethoxy-1-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]hexanoate.
| Compound Name | propan-2-yl 6-[(7,8-dimethoxy-1-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]hexanoate |
|---|---|
| PubChem CID | 158431770 |
| Molecular Formula | C26H31N5O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | propan-2-yl 6-[(7,8-dimethoxy-1-phenyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]hexanoate |
| SMILES | COc1cc2nc(NCCCCCC(=O)OC(C)C)c3nnc(-c4ccccc4)n3c2cc1OC |
| InChI | InChI=1S/C26H31N5O4/c1-17(2)35-23(32)13-9-6-10-14-27-24-26-30-29-25(18-11-7-5-8-12-18)31(26)20-16-22(34-4)21(33-3)15-19(20)28-24/h5,7-8,11-12,15-17H,6,9-10,13-14H2,1-4H3,(H,27,28) |
| InChIKey | HBSYOFUTWIQVKI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|