C22H31N5O2 — CID 162164022
tert-butyl 6-[(1-propan-2-yl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]hexanoate (PubChem CID 162164022) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is tert-butyl 6-[(1-propan-2-yl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]hexanoate.
| Compound Name | tert-butyl 6-[(1-propan-2-yl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]hexanoate |
|---|---|
| PubChem CID | 162164022 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | tert-butyl 6-[(1-propan-2-yl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]hexanoate |
| SMILES | CC(C)c1nnc2c(NCCCCCC(=O)OC(C)(C)C)nc3ccccc3n12 |
| InChI | InChI=1S/C22H31N5O2/c1-15(2)20-25-26-21-19(24-16-11-8-9-12-17(16)27(20)21)23-14-10-6-7-13-18(28)29-22(3,4)5/h8-9,11-12,15H,6-7,10,13-14H2,1-5H3,(H,23,24) |
| InChIKey | ZMWOJUTYEOCJEK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|