C28H33N5O3 — CID 162221100
tert-butyl 6-[[1-methyl-7-(2-phenylacetyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]hexanoate (PubChem CID 162221100) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is tert-butyl 6-[[1-methyl-7-(2-phenylacetyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]hexanoate.
| Compound Name | tert-butyl 6-[[1-methyl-7-(2-phenylacetyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]hexanoate |
|---|---|
| PubChem CID | 162221100 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | tert-butyl 6-[[1-methyl-7-(2-phenylacetyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]hexanoate |
| SMILES | Cc1nnc2c(NCCCCCC(=O)OC(C)(C)C)nc3cc(C(=O)Cc4ccccc4)ccc3n12 |
| InChI | InChI=1S/C28H33N5O3/c1-19-31-32-27-26(29-16-10-6-9-13-25(35)36-28(2,3)4)30-22-18-21(14-15-23(22)33(19)27)24(34)17-20-11-7-5-8-12-20/h5,7-8,11-12,14-15,18H,6,9-10,13,16-17H2,1-4H3,(H,29,30) |
| InChIKey | ZUCZSRSFRHTNSZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|