C19H27N7O — CID 142746083
1-tert-butyl-3-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]urea (PubChem CID 142746083) has the molecular formula C19H27N7O and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-tert-butyl-3-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]urea.
| Compound Name | 1-tert-butyl-3-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]urea |
|---|---|
| PubChem CID | 142746083 |
| Molecular Formula | C19H27N7O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 1-tert-butyl-3-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]urea |
| SMILES | Cc1nnc2c(NCCCCNC(=O)NC(C)(C)C)nc3ccccc3n12 |
| InChI | InChI=1S/C19H27N7O/c1-13-24-25-17-16(22-14-9-5-6-10-15(14)26(13)17)20-11-7-8-12-21-18(27)23-19(2,3)4/h5-6,9-10H,7-8,11-12H2,1-4H3,(H,20,22)(H2,21,23,27) |
| InChIKey | VGNAOWUYNBSUTG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|