C19H26N6O3 — CID 135276426
N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]acetamide (PubChem CID 135276426) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]acetamide.
| Compound Name | N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]acetamide |
|---|---|
| PubChem CID | 135276426 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]acetamide |
| SMILES | COCCOc1ccc2c(c1)nc(NCCCCNC(C)=O)c1nnc(C)n12 |
| InChI | InChI=1S/C19H26N6O3/c1-13-23-24-19-18(21-9-5-4-8-20-14(2)26)22-16-12-15(28-11-10-27-3)6-7-17(16)25(13)19/h6-7,12H,4-5,8-11H2,1-3H3,(H,20,26)(H,21,22) |
| InChIKey | AWGIMQQPBMCRQM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|