C23H34N6O3 — CID 142406733
(2S)-N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]-2,3-dimethylbutanamide (PubChem CID 142406733) has the molecular formula C23H34N6O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is (2S)-N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]-2,3-dimethylbutanamide.
| Compound Name | (2S)-N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]-2,3-dimethylbutanamide |
|---|---|
| PubChem CID | 142406733 |
| Molecular Formula | C23H34N6O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | (2S)-N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]-2,3-dimethylbutanamide |
| SMILES | COCCOc1ccc2c(c1)nc(NCCCCNC(=O)[C@@H](C)C(C)C)c1nnc(C)n12 |
| InChI | InChI=1S/C23H34N6O3/c1-15(2)16(3)23(30)25-11-7-6-10-24-21-22-28-27-17(4)29(22)20-9-8-18(14-19(20)26-21)32-13-12-31-5/h8-9,14-16H,6-7,10-13H2,1-5H3,(H,24,26)(H,25,30)/t16-/m0/s1 |
| InChIKey | IMDFZWZLZNXXKY-INIZCTEOSA-N |
| XLogP | 3.21 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|