C23H33N5O4 — CID 162011918
(3S)-3-hydroxy-9-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]-2-methylnonan-4-one (PubChem CID 162011918) has the molecular formula C23H33N5O4 and a molecular weight of 443.55 g/mol. Its IUPAC name is (3S)-3-hydroxy-9-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]-2-methylnonan-4-one.
| Compound Name | (3S)-3-hydroxy-9-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]-2-methylnonan-4-one |
|---|---|
| PubChem CID | 162011918 |
| Molecular Formula | C23H33N5O4 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | (3S)-3-hydroxy-9-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]-2-methylnonan-4-one |
| SMILES | COCCOc1ccc2c(c1)nc(NCCCCCC(=O)[C@@H](O)C(C)C)c1nnc(C)n12 |
| InChI | InChI=1S/C23H33N5O4/c1-15(2)21(30)20(29)8-6-5-7-11-24-22-23-27-26-16(3)28(23)19-10-9-17(14-18(19)25-22)32-13-12-31-4/h9-10,14-15,21,30H,5-8,11-13H2,1-4H3,(H,24,25)/t21-/m0/s1 |
| InChIKey | PHAIJAOGEHEHEA-NRFANRHFSA-N |
| XLogP | 3.17 |
| TPSA | 110.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|