C22H33N5O3S — CID 158111135
(3S)-3-hydroxy-9-[(7-methoxy-1,8-dimethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]-2-methylnonan-4-one;sulfane (PubChem CID 158111135) has the molecular formula C22H33N5O3S and a molecular weight of 447.61 g/mol. Its IUPAC name is (3S)-3-hydroxy-9-[(7-methoxy-1,8-dimethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]-2-methylnonan-4-one;sulfane.
| Compound Name | (3S)-3-hydroxy-9-[(7-methoxy-1,8-dimethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]-2-methylnonan-4-one;sulfane |
|---|---|
| PubChem CID | 158111135 |
| Molecular Formula | C22H33N5O3S |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | (3S)-3-hydroxy-9-[(7-methoxy-1,8-dimethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]-2-methylnonan-4-one;sulfane |
| SMILES | COc1cc2nc(NCCCCCC(=O)[C@@H](O)C(C)C)c3nnc(C)n3c2cc1C.S |
| InChI | InChI=1S/C22H31N5O3.H2S/c1-13(2)20(29)18(28)9-7-6-8-10-23-21-22-26-25-15(4)27(22)17-11-14(3)19(30-5)12-16(17)24-21;/h11-13,20,29H,6-10H2,1-5H3,(H,23,24);1H2/t20-;/m0./s1 |
| InChIKey | FQLGNNVUWVYIQU-BDQAORGHSA-N |
| XLogP | 3.57 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|