C26H37N5O2 — CID 159824289
2-methyl-9-[[1-methyl-8-(4-methyl-2-oxopentyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]nonan-4-one (PubChem CID 159824289) has the molecular formula C26H37N5O2 and a molecular weight of 451.62 g/mol. Its IUPAC name is 2-methyl-9-[[1-methyl-8-(4-methyl-2-oxopentyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]nonan-4-one.
| Compound Name | 2-methyl-9-[[1-methyl-8-(4-methyl-2-oxopentyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]nonan-4-one |
|---|---|
| PubChem CID | 159824289 |
| Molecular Formula | C26H37N5O2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | 2-methyl-9-[[1-methyl-8-(4-methyl-2-oxopentyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]nonan-4-one |
| SMILES | Cc1nnc2c(NCCCCCC(=O)CC(C)C)nc3ccc(CC(=O)CC(C)C)cc3n12 |
| InChI | InChI=1S/C26H37N5O2/c1-17(2)13-21(32)9-7-6-8-12-27-25-26-30-29-19(5)31(26)24-16-20(10-11-23(24)28-25)15-22(33)14-18(3)4/h10-11,16-18H,6-9,12-15H2,1-5H3,(H,27,28) |
| InChIKey | NMQBRGNQBFSBOF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|