C21H25N5O5 — CID 157494863
[7-[(12-methyl-4,7-dioxa-11,13,14,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),9,12,14,16-hexaen-16-yl)amino]-2-oxoheptyl] acetate (PubChem CID 157494863) has the molecular formula C21H25N5O5 and a molecular weight of 427.46 g/mol. Its IUPAC name is [7-[(12-methyl-4,7-dioxa-11,13,14,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),9,12,14,16-hexaen-16-yl)amino]-2-oxoheptyl] acetate.
| Compound Name | [7-[(12-methyl-4,7-dioxa-11,13,14,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),9,12,14,16-hexaen-16-yl)amino]-2-oxoheptyl] acetate |
|---|---|
| PubChem CID | 157494863 |
| Molecular Formula | C21H25N5O5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | [7-[(12-methyl-4,7-dioxa-11,13,14,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3(8),9,12,14,16-hexaen-16-yl)amino]-2-oxoheptyl] acetate |
| SMILES | CC(=O)OCC(=O)CCCCCNc1nc2cc3c(cc2n2c(C)nnc12)OCCO3 |
| InChI | InChI=1S/C21H25N5O5/c1-13-24-25-21-20(22-7-5-3-4-6-15(28)12-31-14(2)27)23-16-10-18-19(30-9-8-29-18)11-17(16)26(13)21/h10-11H,3-9,12H2,1-2H3,(H,22,23) |
| InChIKey | BXSAHGSGECYAMQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|