C22H26N6O3S — CID 142746015
N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-2-thiophen-2-ylacetamide (PubChem CID 142746015) has the molecular formula C22H26N6O3S and a molecular weight of 454.56 g/mol. Its IUPAC name is N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 142746015 |
| Molecular Formula | C22H26N6O3S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-2-thiophen-2-ylacetamide |
| SMILES | COc1cc2nc(NCCCCNC(=O)Cc3cccs3)c3nnc(C)n3c2cc1OC |
| InChI | InChI=1S/C22H26N6O3S/c1-14-26-27-22-21(24-9-5-4-8-23-20(29)11-15-7-6-10-32-15)25-16-12-18(30-2)19(31-3)13-17(16)28(14)22/h6-7,10,12-13H,4-5,8-9,11H2,1-3H3,(H,23,29)(H,24,25) |
| InChIKey | PZWZNQSNVDESHA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|