C21H24N6O2S — CID 135276218
N-[4-[(7-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-2-thiophen-2-ylacetamide (PubChem CID 135276218) has the molecular formula C21H24N6O2S and a molecular weight of 424.53 g/mol. Its IUPAC name is N-[4-[(7-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-[(7-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 135276218 |
| Molecular Formula | C21H24N6O2S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[4-[(7-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-2-thiophen-2-ylacetamide |
| SMILES | COc1ccc2c(c1)nc(NCCCCNC(=O)Cc1cccs1)c1nnc(C)n12 |
| InChI | InChI=1S/C21H24N6O2S/c1-14-25-26-21-20(24-17-12-15(29-2)7-8-18(17)27(14)21)23-10-4-3-9-22-19(28)13-16-6-5-11-30-16/h5-8,11-12H,3-4,9-10,13H2,1-2H3,(H,22,28)(H,23,24) |
| InChIKey | VUTYMUFQJCGITL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|