C16H20N6O — CID 146342013
N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]acetamide (PubChem CID 146342013) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]acetamide.
| Compound Name | N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]acetamide |
|---|---|
| PubChem CID | 146342013 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]acetamide |
| SMILES | CC(=O)NCCCCNc1nc2ccccc2n2c(C)nnc12 |
| InChI | InChI=1S/C16H20N6O/c1-11-20-21-16-15(18-10-6-5-9-17-12(2)23)19-13-7-3-4-8-14(13)22(11)16/h3-4,7-8H,5-6,9-10H2,1-2H3,(H,17,23)(H,18,19) |
| InChIKey | AIJQTSDZAUHUDP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|