C16H19N5OS — CID 53028750
N-butyl-2-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)sulfanyl]acetamide (PubChem CID 53028750) has the molecular formula C16H19N5OS and a molecular weight of 329.43 g/mol. Its IUPAC name is N-butyl-2-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)sulfanyl]acetamide.
| Compound Name | N-butyl-2-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 53028750 |
| Molecular Formula | C16H19N5OS |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-butyl-2-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)sulfanyl]acetamide |
| SMILES | CCCCNC(=O)CSc1nc2ccccc2n2c(C)nnc12 |
| InChI | InChI=1S/C16H19N5OS/c1-3-4-9-17-14(22)10-23-16-15-20-19-11(2)21(15)13-8-6-5-7-12(13)18-16/h5-8H,3-4,9-10H2,1-2H3,(H,17,22) |
| InChIKey | NHEUZPVKNDXMNS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|