C20H28N6O2 — CID 146342120
tert-butyl N-[5-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]pentyl]carbamate (PubChem CID 146342120) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is tert-butyl N-[5-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]pentyl]carbamate |
|---|---|
| PubChem CID | 146342120 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | tert-butyl N-[5-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]pentyl]carbamate |
| SMILES | Cc1nnc2c(NCCCCCNC(=O)OC(C)(C)C)nc3ccccc3n12 |
| InChI | InChI=1S/C20H28N6O2/c1-14-24-25-18-17(23-15-10-6-7-11-16(15)26(14)18)21-12-8-5-9-13-22-19(27)28-20(2,3)4/h6-7,10-11H,5,8-9,12-13H2,1-4H3,(H,21,23)(H,22,27) |
| InChIKey | AHHMWQPDJMNSQD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|