C30H46N8O4 — CID 142746089
tert-butyl N-[(2S)-1-[4-[[7-(2,6-dimethylmorpholin-4-yl)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butylamino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 142746089) has the molecular formula C30H46N8O4 and a molecular weight of 582.75 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[4-[[7-(2,6-dimethylmorpholin-4-yl)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butylamino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[4-[[7-(2,6-dimethylmorpholin-4-yl)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142746089 |
| Molecular Formula | C30H46N8O4 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.36 |
| IUPAC Name | tert-butyl N-[(2S)-1-[4-[[7-(2,6-dimethylmorpholin-4-yl)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | Cc1nnc2c(NCCCCNC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C)nc3cc(N4CC(C)OC(C)C4)ccc3n12 |
| InChI | InChI=1S/C30H46N8O4/c1-18(2)25(34-29(40)42-30(6,7)8)28(39)32-14-10-9-13-31-26-27-36-35-21(5)38(27)24-12-11-22(15-23(24)33-26)37-16-19(3)41-20(4)17-37/h11-12,15,18-20,25H,9-10,13-14,16-17H2,1-8H3,(H,31,33)(H,32,39)(H,34,40)/t19?,20?,25-/m0/s1 |
| InChIKey | HZSIESHPVVOJIC-FGJIOPLASA-N |
| XLogP | 4.06 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|