C23H36N6O3 — CID 142406464
tert-butyl N-[4-[[3-amino-7-[(2S)-2,6-dimethylmorpholin-4-yl]quinoxalin-2-yl]amino]butyl]carbamate (PubChem CID 142406464) has the molecular formula C23H36N6O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is tert-butyl N-[4-[[3-amino-7-[(2S)-2,6-dimethylmorpholin-4-yl]quinoxalin-2-yl]amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[[3-amino-7-[(2S)-2,6-dimethylmorpholin-4-yl]quinoxalin-2-yl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 142406464 |
| Molecular Formula | C23H36N6O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | tert-butyl N-[4-[[3-amino-7-[(2S)-2,6-dimethylmorpholin-4-yl]quinoxalin-2-yl]amino]butyl]carbamate |
| SMILES | CC1CN(c2ccc3nc(N)c(NCCCCNC(=O)OC(C)(C)C)nc3c2)C[C@H](C)O1 |
| InChI | InChI=1S/C23H36N6O3/c1-15-13-29(14-16(2)31-15)17-8-9-18-19(12-17)28-21(20(24)27-18)25-10-6-7-11-26-22(30)32-23(3,4)5/h8-9,12,15-16H,6-7,10-11,13-14H2,1-5H3,(H2,24,27)(H,25,28)(H,26,30)/t15-,16?/m0/s1 |
| InChIKey | UFJQZJGESBNTIW-VYRBHSGPSA-N |
| XLogP | 3.54 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|