C24H39N7O5 — CID 135276214
tert-butyl N-[4-[[3-hydrazinyl-6-methoxy-7-(2-morpholin-4-ylethoxy)quinoxalin-2-yl]amino]butyl]carbamate (PubChem CID 135276214) has the molecular formula C24H39N7O5 and a molecular weight of 505.62 g/mol. Its IUPAC name is tert-butyl N-[4-[[3-hydrazinyl-6-methoxy-7-(2-morpholin-4-ylethoxy)quinoxalin-2-yl]amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[[3-hydrazinyl-6-methoxy-7-(2-morpholin-4-ylethoxy)quinoxalin-2-yl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 135276214 |
| Molecular Formula | C24H39N7O5 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | tert-butyl N-[4-[[3-hydrazinyl-6-methoxy-7-(2-morpholin-4-ylethoxy)quinoxalin-2-yl]amino]butyl]carbamate |
| SMILES | COc1cc2nc(NN)c(NCCCCNC(=O)OC(C)(C)C)nc2cc1OCCN1CCOCC1 |
| InChI | InChI=1S/C24H39N7O5/c1-24(2,3)36-23(32)27-8-6-5-7-26-21-22(30-25)29-17-15-19(33-4)20(16-18(17)28-21)35-14-11-31-9-12-34-13-10-31/h15-16H,5-14,25H2,1-4H3,(H,26,28)(H,27,32)(H,29,30) |
| InChIKey | FKUYLJWHDKJDIA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 145.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|