C26H47N7O5 — CID 142406634
tert-butyl N-[4-[[1-[2-amino-4-methoxy-5-(2-morpholin-4-ylethoxy)anilino]-2-[amino(methyl)amino]propylidene]amino]butyl]carbamate (PubChem CID 142406634) has the molecular formula C26H47N7O5 and a molecular weight of 537.71 g/mol. Its IUPAC name is tert-butyl N-[4-[[1-[2-amino-4-methoxy-5-(2-morpholin-4-ylethoxy)anilino]-2-[amino(methyl)amino]propylidene]amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[[1-[2-amino-4-methoxy-5-(2-morpholin-4-ylethoxy)anilino]-2-[amino(methyl)amino]propylidene]amino]butyl]carbamate |
|---|---|
| PubChem CID | 142406634 |
| Molecular Formula | C26H47N7O5 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.36 |
| IUPAC Name | tert-butyl N-[4-[[1-[2-amino-4-methoxy-5-(2-morpholin-4-ylethoxy)anilino]-2-[amino(methyl)amino]propylidene]amino]butyl]carbamate |
| SMILES | COc1cc(N)c(N/C(=N/CCCCNC(=O)OC(C)(C)C)C(C)N(C)N)cc1OCCN1CCOCC1 |
| InChI | InChI=1S/C26H47N7O5/c1-19(32(5)28)24(29-9-7-8-10-30-25(34)38-26(2,3)4)31-21-18-23(22(35-6)17-20(21)27)37-16-13-33-11-14-36-15-12-33/h17-19H,7-16,27-28H2,1-6H3,(H,29,31)(H,30,34) |
| InChIKey | YYSZKTWYNJCRNC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|