C23H40IN5O4 — CID 111887336
tert-butyl N-[3-[[N'-methyl-N-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111887336) has the molecular formula C23H40IN5O4 and a molecular weight of 577.51 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-methyl-N-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N'-methyl-N-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111887336 |
| Molecular Formula | C23H40IN5O4 |
| Molecular Weight | 577.51 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | tert-butyl N-[3-[[N'-methyl-N-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCc1ccccc1OCCN1CCOCC1.I |
| InChI | InChI=1S/C23H39N5O4.HI/c1-23(2,3)32-22(29)26-11-7-10-25-21(24-4)27-18-19-8-5-6-9-20(19)31-17-14-28-12-15-30-16-13-28;/h5-6,8-9H,7,10-18H2,1-4H3,(H,26,29)(H2,24,25,27);1H |
| InChIKey | BKYJSOVFVDPTED-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|