C20H34N4O2S — CID 111611678
2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine (PubChem CID 111611678) has the molecular formula C20H34N4O2S and a molecular weight of 394.59 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111611678 |
| Molecular Formula | C20H34N4O2S |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccccc1OCCN1CCOCC1)NCC(C)(C)SC |
| InChI | InChI=1S/C20H34N4O2S/c1-20(2,27-4)16-23-19(21-3)22-15-17-7-5-6-8-18(17)26-14-11-24-9-12-25-13-10-24/h5-8H,9-16H2,1-4H3,(H2,21,22,23) |
| InChIKey | YJUCKVKRLYOEGR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|