C22H29N7O2 — CID 111013857
2-methyl-1-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111013857) has the molecular formula C22H29N7O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 2-methyl-1-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111013857 |
| Molecular Formula | C22H29N7O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 2-methyl-1-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1ccccc1OCCN1CCOCC1)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C22H29N7O2/c1-23-22(25-17-21-27-26-20-8-4-5-9-29(20)21)24-16-18-6-2-3-7-19(18)31-15-12-28-10-13-30-14-11-28/h2-9H,10-17H2,1H3,(H2,23,24,25) |
| InChIKey | GCBUQGLNHNSART-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 88.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|