C23H31IN4O4 — CID 111845892
1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111845892) has the molecular formula C23H31IN4O4 and a molecular weight of 554.43 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111845892 |
| Molecular Formula | C23H31IN4O4 |
| Molecular Weight | 554.43 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[[2-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc2c(c1)OCO2)NCc1ccccc1OCCN1CCOCC1.I |
| InChI | InChI=1S/C23H30N4O4.HI/c1-24-23(25-15-18-6-7-21-22(14-18)31-17-30-21)26-16-19-4-2-3-5-20(19)29-13-10-27-8-11-28-12-9-27;/h2-7,14H,8-13,15-17H2,1H3,(H2,24,25,26);1H |
| InChIKey | WZCKZJBOMAZPAK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|