C22H38IN5O4 — CID 111885028
tert-butyl N-[2-[[N'-methyl-N-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111885028) has the molecular formula C22H38IN5O4 and a molecular weight of 563.48 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-methyl-N-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N'-methyl-N-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111885028 |
| Molecular Formula | C22H38IN5O4 |
| Molecular Weight | 563.48 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | tert-butyl N-[2-[[N'-methyl-N-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)OC(C)(C)C)NCc1cccc(OCCN2CCOCC2)c1.I |
| InChI | InChI=1S/C22H37N5O4.HI/c1-22(2,3)31-21(28)25-9-8-24-20(23-4)26-17-18-6-5-7-19(16-18)30-15-12-27-10-13-29-14-11-27;/h5-7,16H,8-15,17H2,1-4H3,(H,25,28)(H2,23,24,26);1H |
| InChIKey | SRLORYOJAIGQDS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|