C23H36IN5O3 — CID 111594609
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111594609) has the molecular formula C23H36IN5O3 and a molecular weight of 557.48 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111594609 |
| Molecular Formula | C23H36IN5O3 |
| Molecular Weight | 557.48 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(OCCN2CCOCC2)c1)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C23H35N5O3.HI/c1-23(2,3)20-16-25-21(31-20)17-27-22(24-4)26-15-18-6-5-7-19(14-18)30-13-10-28-8-11-29-12-9-28;/h5-7,14,16H,8-13,15,17H2,1-4H3,(H2,24,26,27);1H |
| InChIKey | BWBJSPWPSYYPAL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|