C23H34N6O4 — CID 117090671
1-[3-[[6,7-dimethoxy-4-(2-morpholin-4-ylethylamino)quinazolin-2-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117090671) has the molecular formula C23H34N6O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is 1-[3-[[6,7-dimethoxy-4-(2-morpholin-4-ylethylamino)quinazolin-2-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[6,7-dimethoxy-4-(2-morpholin-4-ylethylamino)quinazolin-2-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117090671 |
| Molecular Formula | C23H34N6O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 1-[3-[[6,7-dimethoxy-4-(2-morpholin-4-ylethylamino)quinazolin-2-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | COc1cc2nc(NCCCN3CCCC3=O)nc(NCCN3CCOCC3)c2cc1OC |
| InChI | InChI=1S/C23H34N6O4/c1-31-19-15-17-18(16-20(19)32-2)26-23(25-6-4-9-29-8-3-5-21(29)30)27-22(17)24-7-10-28-11-13-33-14-12-28/h15-16H,3-14H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | FYYUHODQXQWODO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|