C25H39N5O4 — CID 160557752
tert-butyl 6-[[3-(aminomethyl)-7-(2-morpholin-4-ylethoxy)quinoxalin-2-yl]amino]hexanoate (PubChem CID 160557752) has the molecular formula C25H39N5O4 and a molecular weight of 473.62 g/mol. Its IUPAC name is tert-butyl 6-[[3-(aminomethyl)-7-(2-morpholin-4-ylethoxy)quinoxalin-2-yl]amino]hexanoate.
| Compound Name | tert-butyl 6-[[3-(aminomethyl)-7-(2-morpholin-4-ylethoxy)quinoxalin-2-yl]amino]hexanoate |
|---|---|
| PubChem CID | 160557752 |
| Molecular Formula | C25H39N5O4 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | tert-butyl 6-[[3-(aminomethyl)-7-(2-morpholin-4-ylethoxy)quinoxalin-2-yl]amino]hexanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCNc1nc2cc(OCCN3CCOCC3)ccc2nc1CN |
| InChI | InChI=1S/C25H39N5O4/c1-25(2,3)34-23(31)7-5-4-6-10-27-24-22(18-26)28-20-9-8-19(17-21(20)29-24)33-16-13-30-11-14-32-15-12-30/h8-9,17H,4-7,10-16,18,26H2,1-3H3,(H,27,29) |
| InChIKey | HFTDOQVEKPTLFA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 111.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|