C19H26ClN3O3 — CID 158488218
tert-butyl 6-[(3-chloro-7-methoxyquinoxalin-2-yl)amino]hexanoate (PubChem CID 158488218) has the molecular formula C19H26ClN3O3 and a molecular weight of 379.89 g/mol. Its IUPAC name is tert-butyl 6-[(3-chloro-7-methoxyquinoxalin-2-yl)amino]hexanoate.
| Compound Name | tert-butyl 6-[(3-chloro-7-methoxyquinoxalin-2-yl)amino]hexanoate |
|---|---|
| PubChem CID | 158488218 |
| Molecular Formula | C19H26ClN3O3 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | tert-butyl 6-[(3-chloro-7-methoxyquinoxalin-2-yl)amino]hexanoate |
| SMILES | COc1ccc2nc(Cl)c(NCCCCCC(=O)OC(C)(C)C)nc2c1 |
| InChI | InChI=1S/C19H26ClN3O3/c1-19(2,3)26-16(24)8-6-5-7-11-21-18-17(20)22-14-10-9-13(25-4)12-15(14)23-18/h9-10,12H,5-8,11H2,1-4H3,(H,21,23) |
| InChIKey | ZGSGORWEOYQRKH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|