C19H25Cl2N3O3 — CID 158891299
tert-butyl 6-[(3,8-dichloro-7-methoxyquinoxalin-2-yl)amino]hexanoate (PubChem CID 158891299) has the molecular formula C19H25Cl2N3O3 and a molecular weight of 414.33 g/mol. Its IUPAC name is tert-butyl 6-[(3,8-dichloro-7-methoxyquinoxalin-2-yl)amino]hexanoate.
| Compound Name | tert-butyl 6-[(3,8-dichloro-7-methoxyquinoxalin-2-yl)amino]hexanoate |
|---|---|
| PubChem CID | 158891299 |
| Molecular Formula | C19H25Cl2N3O3 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | tert-butyl 6-[(3,8-dichloro-7-methoxyquinoxalin-2-yl)amino]hexanoate |
| SMILES | COc1ccc2nc(Cl)c(NCCCCCC(=O)OC(C)(C)C)nc2c1Cl |
| InChI | InChI=1S/C19H25Cl2N3O3/c1-19(2,3)27-14(25)8-6-5-7-11-22-18-17(21)23-12-9-10-13(26-4)15(20)16(12)24-18/h9-10H,5-8,11H2,1-4H3,(H,22,24) |
| InChIKey | AELXXKMANAVFCM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|