C12H18ClN3O3 — CID 80753174
methyl 6-[(5-chloro-2-methoxypyrimidin-4-yl)amino]hexanoate (PubChem CID 80753174) has the molecular formula C12H18ClN3O3 and a molecular weight of 287.75 g/mol. Its IUPAC name is methyl 6-[(5-chloro-2-methoxypyrimidin-4-yl)amino]hexanoate.
| Compound Name | methyl 6-[(5-chloro-2-methoxypyrimidin-4-yl)amino]hexanoate |
|---|---|
| PubChem CID | 80753174 |
| Molecular Formula | C12H18ClN3O3 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | methyl 6-[(5-chloro-2-methoxypyrimidin-4-yl)amino]hexanoate |
| SMILES | COC(=O)CCCCCNc1nc(OC)ncc1Cl |
| InChI | InChI=1S/C12H18ClN3O3/c1-18-10(17)6-4-3-5-7-14-11-9(13)8-15-12(16-11)19-2/h8H,3-7H2,1-2H3,(H,14,15,16) |
| InChIKey | BFWNNFDIJQCVTJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|