C21H29N5O3 — CID 160504434
tert-butyl 6-[(6-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]hexanoate (PubChem CID 160504434) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is tert-butyl 6-[(6-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]hexanoate.
| Compound Name | tert-butyl 6-[(6-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]hexanoate |
|---|---|
| PubChem CID | 160504434 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | tert-butyl 6-[(6-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]hexanoate |
| SMILES | COc1cccc2c1nc(NCCCCCC(=O)OC(C)(C)C)c1nnc(C)n12 |
| InChI | InChI=1S/C21H29N5O3/c1-14-24-25-20-19(22-13-8-6-7-12-17(27)29-21(2,3)4)23-18-15(26(14)20)10-9-11-16(18)28-5/h9-11H,6-8,12-13H2,1-5H3,(H,22,23) |
| InChIKey | QSEZJHFXLDGPNO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|