C20H27ClN6O2 — CID 146342131
N-[4-[(6-chloro-7-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-methylbutanamide (PubChem CID 146342131) has the molecular formula C20H27ClN6O2 and a molecular weight of 418.93 g/mol. Its IUPAC name is N-[4-[(6-chloro-7-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-methylbutanamide.
| Compound Name | N-[4-[(6-chloro-7-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 146342131 |
| Molecular Formula | C20H27ClN6O2 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[4-[(6-chloro-7-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-methylbutanamide |
| SMILES | COc1ccc2c(nc(NCCCCNC(=O)CC(C)C)c3nnc(C)n32)c1Cl |
| InChI | InChI=1S/C20H27ClN6O2/c1-12(2)11-16(28)22-9-5-6-10-23-19-20-26-25-13(3)27(20)14-7-8-15(29-4)17(21)18(14)24-19/h7-8,12H,5-6,9-11H2,1-4H3,(H,22,28)(H,23,24) |
| InChIKey | ABIMKPHPMGFDFD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|