C27H31N7O2 — CID 135276298
N-[4-[[7-[(4-cyanophenyl)methoxy]-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]-3-methylbutanamide (PubChem CID 135276298) has the molecular formula C27H31N7O2 and a molecular weight of 485.59 g/mol. Its IUPAC name is N-[4-[[7-[(4-cyanophenyl)methoxy]-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]-3-methylbutanamide.
| Compound Name | N-[4-[[7-[(4-cyanophenyl)methoxy]-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 135276298 |
| Molecular Formula | C27H31N7O2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | N-[4-[[7-[(4-cyanophenyl)methoxy]-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]-3-methylbutanamide |
| SMILES | Cc1nnc2c(NCCCCNC(=O)CC(C)C)nc3cc(OCc4ccc(C#N)cc4)ccc3n12 |
| InChI | InChI=1S/C27H31N7O2/c1-18(2)14-25(35)29-12-4-5-13-30-26-27-33-32-19(3)34(27)24-11-10-22(15-23(24)31-26)36-17-21-8-6-20(16-28)7-9-21/h6-11,15,18H,4-5,12-14,17H2,1-3H3,(H,29,35)(H,30,31) |
| InChIKey | QVXRIYZATKLECX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|