C20H29ClN4O3 — CID 158891300
tert-butyl 6-[[3-(aminomethyl)-8-chloro-7-methoxyquinoxalin-2-yl]amino]hexanoate (PubChem CID 158891300) has the molecular formula C20H29ClN4O3 and a molecular weight of 408.93 g/mol. Its IUPAC name is tert-butyl 6-[[3-(aminomethyl)-8-chloro-7-methoxyquinoxalin-2-yl]amino]hexanoate.
| Compound Name | tert-butyl 6-[[3-(aminomethyl)-8-chloro-7-methoxyquinoxalin-2-yl]amino]hexanoate |
|---|---|
| PubChem CID | 158891300 |
| Molecular Formula | C20H29ClN4O3 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | tert-butyl 6-[[3-(aminomethyl)-8-chloro-7-methoxyquinoxalin-2-yl]amino]hexanoate |
| SMILES | COc1ccc2nc(CN)c(NCCCCCC(=O)OC(C)(C)C)nc2c1Cl |
| InChI | InChI=1S/C20H29ClN4O3/c1-20(2,3)28-16(26)8-6-5-7-11-23-19-14(12-22)24-13-9-10-15(27-4)17(21)18(13)25-19/h9-10H,5-8,11-12,22H2,1-4H3,(H,23,25) |
| InChIKey | SDCPAYAPVNJEKV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|