C9H10N4O3 — CID 135778350
N-[3-(hydroxyamino)-6-methoxyquinoxalin-2-yl]hydroxylamine (PubChem CID 135778350) has the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. Its IUPAC name is N-[3-(hydroxyamino)-6-methoxyquinoxalin-2-yl]hydroxylamine.
| Compound Name | N-[3-(hydroxyamino)-6-methoxyquinoxalin-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 135778350 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-[3-(hydroxyamino)-6-methoxyquinoxalin-2-yl]hydroxylamine |
| SMILES | COc1ccc2nc(NO)c(NO)nc2c1 |
| InChI | InChI=1S/C9H10N4O3/c1-16-5-2-3-6-7(4-5)11-9(13-15)8(10-6)12-14/h2-4,14-15H,1H3,(H,10,12)(H,11,13) |
| InChIKey | ASIJOWQAHJCURU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|