C15H10Cl3N3O3S — CID 86612114
2,3-dichloro-N-(3-chloro-7-methoxyquinoxalin-2-yl)benzenesulfonamide (PubChem CID 86612114) has the molecular formula C15H10Cl3N3O3S and a molecular weight of 418.69 g/mol. Its IUPAC name is 2,3-dichloro-N-(3-chloro-7-methoxyquinoxalin-2-yl)benzenesulfonamide.
| Compound Name | 2,3-dichloro-N-(3-chloro-7-methoxyquinoxalin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 86612114 |
| Molecular Formula | C15H10Cl3N3O3S |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 416.95 |
| IUPAC Name | 2,3-dichloro-N-(3-chloro-7-methoxyquinoxalin-2-yl)benzenesulfonamide |
| SMILES | COc1ccc2nc(Cl)c(NS(=O)(=O)c3cccc(Cl)c3Cl)nc2c1 |
| InChI | InChI=1S/C15H10Cl3N3O3S/c1-24-8-5-6-10-11(7-8)20-15(14(18)19-10)21-25(22,23)12-4-2-3-9(16)13(12)17/h2-7H,1H3,(H,20,21) |
| InChIKey | FROFOLMQIGYCMT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |