About 2,3-dichloro-N-[3-(2,4-dimethylpentan-3-yloxy)quinoxalin-2-yl]benzenesulfonamide
2,3-dichloro-N-[3-(2,4-dimethylpentan-3-yloxy)quinoxalin-2-yl]benzenesulfonamide (PubChem CID 67403098) has the molecular formula C21H23Cl2N3O3S
and a molecular weight of 468.41 g/mol. Its IUPAC name is 2,3-dichloro-N-[3-(2,4-dimethylpentan-3-yloxy)quinoxalin-2-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 2,3-dichloro-N-[3-(2,4-dimethylpentan-3-yloxy)quinoxalin-2-yl]benzenesulfonamide |
| PubChem CID | 67403098 |
| Molecular Formula | C21H23Cl2N3O3S |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 2,3-dichloro-N-[3-(2,4-dimethylpentan-3-yloxy)quinoxalin-2-yl]benzenesulfonamide |
| SMILES | CC(C)C(Oc1nc2ccccc2nc1NS(=O)(=O)c1cccc(Cl)c1Cl)C(C)C |
| InChI | InChI=1S/C21H23Cl2N3O3S/c1-12(2)19(13(3)4)29-21-20(24-15-9-5-6-10-16(15)25-21)26-30(27,28)17-11-7-8-14(22)18(17)23/h5-13,19H,1-4H3,(H,24,26) |
| InChIKey | ZOHMACMUXCMMPS-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,3-dichloro-N-[3-(2,4-dimethylpentan-3-yloxy)quinoxalin-2-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dichloro-N-[3-(2,4-dimethylpentan-3-yloxy)quinoxalin-2-yl]benzenesulfonamide?
The IUPAC name of 2,3-dichloro-N-[3-(2,4-dimethylpentan-3-yloxy)quinoxalin-2-yl]benzenesulfonamide (CID 67403098) is 2,3-dichloro-N-[3-(2,4-dimethylpentan-3-yloxy)quinoxalin-2-yl]benzenesulfonamide.
What is the SMILES notation for 2,3-dichloro-N-[3-(2,4-dimethylpentan-3-yloxy)quinoxalin-2-yl]benzenesulfonamide?
The canonical SMILES for 2,3-dichloro-N-[3-(2,4-dimethylpentan-3-yloxy)quinoxalin-2-yl]benzenesulfonamide is CC(C)C(Oc1nc2ccccc2nc1NS(=O)(=O)c1cccc(Cl)c1Cl)C(C)C.
What is the InChIKey of 2,3-dichloro-N-[3-(2,4-dimethylpentan-3-yloxy)quinoxalin-2-yl]benzenesulfonamide?
The InChIKey is ZOHMACMUXCMMPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23Cl2N3O3S/c1-12(2)19(13(3)4)29-21-20(24-15-9-5-6-10-16(15)25-21)26-30(27,28)17-11-7-8-14(22)18(17)23/h5-13,19H,1-4H3,(H,24,26).
What are the key properties of 2,3-dichloro-N-[3-(2,4-dimethylpentan-3-yloxy)quinoxalin-2-yl]benzenesulfonamide?
2,3-dichloro-N-[3-(2,4-dimethylpentan-3-yloxy)quinoxalin-2-yl]benzenesulfonamide has a molecular weight of 468.41 g/mol, XLogP of 5.80, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloro-N-[3-(2,4-dimethylpentan-3-yloxy)quinoxalin-2-yl]benzenesulfonamide is sourced from PubChem (CID 67403098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).