About N-[3-[1,3-bis(dimethylamino)propan-2-yloxy]quinoxalin-2-yl]-2-chlorobenzenesulfonamide
N-[3-[1,3-bis(dimethylamino)propan-2-yloxy]quinoxalin-2-yl]-2-chlorobenzenesulfonamide (PubChem CID 67402134) has the molecular formula C21H26ClN5O3S
and a molecular weight of 463.99 g/mol. Its IUPAC name is N-[3-[1,3-bis(dimethylamino)propan-2-yloxy]quinoxalin-2-yl]-2-chlorobenzenesulfonamide.
Molecular Properties
| Compound Name | N-[3-[1,3-bis(dimethylamino)propan-2-yloxy]quinoxalin-2-yl]-2-chlorobenzenesulfonamide |
| PubChem CID | 67402134 |
| Molecular Formula | C21H26ClN5O3S |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | N-[3-[1,3-bis(dimethylamino)propan-2-yloxy]quinoxalin-2-yl]-2-chlorobenzenesulfonamide |
| SMILES | CN(C)CC(CN(C)C)Oc1nc2ccccc2nc1NS(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C21H26ClN5O3S/c1-26(2)13-15(14-27(3)4)30-21-20(23-17-10-6-7-11-18(17)24-21)25-31(28,29)19-12-8-5-9-16(19)22/h5-12,15H,13-14H2,1-4H3,(H,23,25) |
| InChIKey | PFDKVGMUTZBFFK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[3-[1,3-bis(dimethylamino)propan-2-yloxy]quinoxalin-2-yl]-2-chlorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[1,3-bis(dimethylamino)propan-2-yloxy]quinoxalin-2-yl]-2-chlorobenzenesulfonamide?
The IUPAC name of N-[3-[1,3-bis(dimethylamino)propan-2-yloxy]quinoxalin-2-yl]-2-chlorobenzenesulfonamide (CID 67402134) is N-[3-[1,3-bis(dimethylamino)propan-2-yloxy]quinoxalin-2-yl]-2-chlorobenzenesulfonamide.
What is the SMILES notation for N-[3-[1,3-bis(dimethylamino)propan-2-yloxy]quinoxalin-2-yl]-2-chlorobenzenesulfonamide?
The canonical SMILES for N-[3-[1,3-bis(dimethylamino)propan-2-yloxy]quinoxalin-2-yl]-2-chlorobenzenesulfonamide is CN(C)CC(CN(C)C)Oc1nc2ccccc2nc1NS(=O)(=O)c1ccccc1Cl.
What is the InChIKey of N-[3-[1,3-bis(dimethylamino)propan-2-yloxy]quinoxalin-2-yl]-2-chlorobenzenesulfonamide?
The InChIKey is PFDKVGMUTZBFFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26ClN5O3S/c1-26(2)13-15(14-27(3)4)30-21-20(23-17-10-6-7-11-18(17)24-21)25-31(28,29)19-12-8-5-9-16(19)22/h5-12,15H,13-14H2,1-4H3,(H,23,25).
What are the key properties of N-[3-[1,3-bis(dimethylamino)propan-2-yloxy]quinoxalin-2-yl]-2-chlorobenzenesulfonamide?
N-[3-[1,3-bis(dimethylamino)propan-2-yloxy]quinoxalin-2-yl]-2-chlorobenzenesulfonamide has a molecular weight of 463.99 g/mol, XLogP of 2.95, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[1,3-bis(dimethylamino)propan-2-yloxy]quinoxalin-2-yl]-2-chlorobenzenesulfonamide is sourced from PubChem (CID 67402134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).