C21H13Cl2F3N4O3S — CID 87386004
2-chloro-N-[3-[1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethoxy]quinoxalin-2-yl]benzenesulfonamide (PubChem CID 87386004) has the molecular formula C21H13Cl2F3N4O3S and a molecular weight of 529.33 g/mol. Its IUPAC name is 2-chloro-N-[3-[1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethoxy]quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[3-[1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethoxy]quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 87386004 |
| Molecular Formula | C21H13Cl2F3N4O3S |
| Molecular Weight | 529.33 g/mol |
| Exact Mass | 528.00 |
| IUPAC Name | 2-chloro-N-[3-[1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethoxy]quinoxalin-2-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccccc2nc1OC(c1ccc(Cl)nc1)C(F)(F)F)c1ccccc1Cl |
| InChI | InChI=1S/C21H13Cl2F3N4O3S/c22-13-5-1-4-8-16(13)34(31,32)30-19-20(29-15-7-3-2-6-14(15)28-19)33-18(21(24,25)26)12-9-10-17(23)27-11-12/h1-11,18H,(H,28,30) |
| InChIKey | KWXSCQOTODSWOF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.33 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|