C22H30N4O4 — CID 3418737
tert-butyl N-[6-[2-[(6-methoxyquinolin-2-yl)methylidene]hydrazinyl]-6-oxohexyl]carbamate (PubChem CID 3418737) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is tert-butyl N-[6-[2-[(6-methoxyquinolin-2-yl)methylidene]hydrazinyl]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[6-[2-[(6-methoxyquinolin-2-yl)methylidene]hydrazinyl]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 3418737 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | tert-butyl N-[6-[2-[(6-methoxyquinolin-2-yl)methylidene]hydrazinyl]-6-oxohexyl]carbamate |
| SMILES | COc1ccc2nc(C=NNC(=O)CCCCCNC(=O)OC(C)(C)C)ccc2c1 |
| InChI | InChI=1S/C22H30N4O4/c1-22(2,3)30-21(28)23-13-7-5-6-8-20(27)26-24-15-17-10-9-16-14-18(29-4)11-12-19(16)25-17/h9-12,14-15H,5-8,13H2,1-4H3,(H,23,28)(H,26,27) |
| InChIKey | OVZQPDCTBLERMQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|