C19H24N4O4 — CID 92506828
tert-butyl N-[(2R)-1-[(2Z)-2-[(6-methoxyquinolin-2-yl)methylidene]hydrazinyl]-1-oxopropan-2-yl]carbamate (PubChem CID 92506828) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[(2Z)-2-[(6-methoxyquinolin-2-yl)methylidene]hydrazinyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[(2Z)-2-[(6-methoxyquinolin-2-yl)methylidene]hydrazinyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 92506828 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | tert-butyl N-[(2R)-1-[(2Z)-2-[(6-methoxyquinolin-2-yl)methylidene]hydrazinyl]-1-oxopropan-2-yl]carbamate |
| SMILES | COc1ccc2nc(/C=N\NC(=O)[C@@H](C)NC(=O)OC(C)(C)C)ccc2c1 |
| InChI | InChI=1S/C19H24N4O4/c1-12(21-18(25)27-19(2,3)4)17(24)23-20-11-14-7-6-13-10-15(26-5)8-9-16(13)22-14/h6-12H,1-5H3,(H,21,25)(H,23,24)/b20-11-/t12-/m1/s1 |
| InChIKey | GHVIJXUCZKWOGA-WXYNYTDUSA-N |
| XLogP | 2.61 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|