C30H38N4O8 — CID 98310557
[2-[(Z)-[[10-[(2Z)-2-[(2-acetyloxy-5-methoxyphenyl)methylidene]hydrazinyl]-10-oxodecanoyl]hydrazinylidene]methyl]-4-methoxyphenyl] acetate (PubChem CID 98310557) has the molecular formula C30H38N4O8 and a molecular weight of 582.65 g/mol. Its IUPAC name is [2-[(Z)-[[10-[(2Z)-2-[(2-acetyloxy-5-methoxyphenyl)methylidene]hydrazinyl]-10-oxodecanoyl]hydrazinylidene]methyl]-4-methoxyphenyl] acetate.
| Compound Name | [2-[(Z)-[[10-[(2Z)-2-[(2-acetyloxy-5-methoxyphenyl)methylidene]hydrazinyl]-10-oxodecanoyl]hydrazinylidene]methyl]-4-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 98310557 |
| Molecular Formula | C30H38N4O8 |
| Molecular Weight | 582.65 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | [2-[(Z)-[[10-[(2Z)-2-[(2-acetyloxy-5-methoxyphenyl)methylidene]hydrazinyl]-10-oxodecanoyl]hydrazinylidene]methyl]-4-methoxyphenyl] acetate |
| SMILES | COc1ccc(OC(C)=O)c(/C=N\NC(=O)CCCCCCCCC(=O)N/N=C\c2cc(OC)ccc2OC(C)=O)c1 |
| InChI | InChI=1S/C30H38N4O8/c1-21(35)41-27-15-13-25(39-3)17-23(27)19-31-33-29(37)11-9-7-5-6-8-10-12-30(38)34-32-20-24-18-26(40-4)14-16-28(24)42-22(2)36/h13-20H,5-12H2,1-4H3,(H,33,37)(H,34,38)/b31-19-,32-20- |
| InChIKey | YQWCDEWKWBXAIK-CDSIFPFTSA-N |
| XLogP | 4.28 |
| TPSA | 153.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.65 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|