C22H26N2O5 — CID 46501404
[2-[(E)-[[2-(4-butylphenoxy)acetyl]hydrazinylidene]methyl]-4-methoxyphenyl] acetate (PubChem CID 46501404) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is [2-[(E)-[[2-(4-butylphenoxy)acetyl]hydrazinylidene]methyl]-4-methoxyphenyl] acetate.
| Compound Name | [2-[(E)-[[2-(4-butylphenoxy)acetyl]hydrazinylidene]methyl]-4-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 46501404 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [2-[(E)-[[2-(4-butylphenoxy)acetyl]hydrazinylidene]methyl]-4-methoxyphenyl] acetate |
| SMILES | CCCCc1ccc(OCC(=O)N/N=C/c2cc(OC)ccc2OC(C)=O)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-4-5-6-17-7-9-19(10-8-17)28-15-22(26)24-23-14-18-13-20(27-3)11-12-21(18)29-16(2)25/h7-14H,4-6,15H2,1-3H3,(H,24,26)/b23-14+ |
| InChIKey | CYDLRVSBLQVHOX-OEAKJJBVSA-N |
| XLogP | 3.49 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|