C22H25BrN2O3 — CID 6874052
N-[(E)-(2-bromo-5-prop-2-enoxyphenyl)methylideneamino]-2-(4-butylphenoxy)acetamide (PubChem CID 6874052) has the molecular formula C22H25BrN2O3 and a molecular weight of 445.36 g/mol. Its IUPAC name is N-[(E)-(2-bromo-5-prop-2-enoxyphenyl)methylideneamino]-2-(4-butylphenoxy)acetamide.
| Compound Name | N-[(E)-(2-bromo-5-prop-2-enoxyphenyl)methylideneamino]-2-(4-butylphenoxy)acetamide |
|---|---|
| PubChem CID | 6874052 |
| Molecular Formula | C22H25BrN2O3 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | N-[(E)-(2-bromo-5-prop-2-enoxyphenyl)methylideneamino]-2-(4-butylphenoxy)acetamide |
| SMILES | C=CCOc1ccc(Br)c(/C=N/NC(=O)COc2ccc(CCCC)cc2)c1 |
| InChI | InChI=1S/C22H25BrN2O3/c1-3-5-6-17-7-9-19(10-8-17)28-16-22(26)25-24-15-18-14-20(27-13-4-2)11-12-21(18)23/h4,7-12,14-15H,2-3,5-6,13,16H2,1H3,(H,25,26)/b24-15+ |
| InChIKey | QCOHNQBFFLSIIU-BUVRLJJBSA-N |
| XLogP | 4.89 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|